CAS 854626-79-2 is the registry number for (4R)-6-Methoxycarbonyl-4-phenyl-3,4-dihydrocoumarin. Offered by: TRC. Available pack sizes: 100mg.
Methyl (4R)-2-oxo-4-phenyl-3,4-dihydrochromene-6-carboxylate (CAS 854626-79-2) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: methyl (4R)-2-oxo-4-phenyl-3,4-dihydrochromene-6-carboxylate. InChIKey: KJRRDCSIUBYJLB-CYBMUJFWSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | methyl (4R)-2-oxo-4-phenyl-3,4-dihydrochromene-6-carboxylate |
| InChIKey | KJRRDCSIUBYJLB-CYBMUJFWSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OC(=O)C[C@@H]2C3=CC=CC=C3 |
Computed by PubChem (NCBI)