CAS 380636-46-4 is the registry number for (4R)-Methyl 2-Hydroxy-4-phenylchroman-6-carboxylate. Offered by: TRC. Available pack sizes: 250mg.
Methyl (4R)-2-hydroxy-4-phenyl-3,4-dihydro-2H-chromene-6-carboxylate (CAS 380636-46-4) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: methyl (4R)-2-hydroxy-4-phenyl-3,4-dihydro-2H-chromene-6-carboxylate. InChIKey: OBYXSRDDEDGPLK-JBZHPUCOSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | methyl (4R)-2-hydroxy-4-phenyl-3,4-dihydro-2H-chromene-6-carboxylate |
| InChIKey | OBYXSRDDEDGPLK-JBZHPUCOSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OC(C[C@@H]2C3=CC=CC=C3)O |
Computed by PubChem (NCBI)