Products 380648-88-4

CAS 380648-88-4 is the registry number for Methyl 1-amino-4-methoxycyclohexanecarboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Methyl 1-amino-4-methoxycyclohexane-1-carboxylate;hydrochloride (CAS 380648-88-4) is a chemical compound with the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. IUPAC name: methyl 1-amino-4-methoxycyclohexane-1-carboxylate;hydrochloride. InChIKey: XLMIJTWFQOPHSR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO3
Molecular weight223.70 g/mol
IUPAC namemethyl 1-amino-4-methoxycyclohexane-1-carboxylate;hydrochloride
InChIKeyXLMIJTWFQOPHSR-UHFFFAOYSA-N
SMILESCOC1CCC(CC1)(C(=O)OC)N.Cl

Computed by PubChem (NCBI)