Products 3807-77-0
CAS 3807-77-0 is the registry number for 3-Nitroacenaphthene. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
3-nitro-1,2-dihydroacenaphthylene (CAS 3807-77-0) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 3-nitro-1,2-dihydroacenaphthylene. InChIKey: WTRQPBAHQILXND-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 3-nitro-1,2-dihydroacenaphthylene |
| InChIKey | WTRQPBAHQILXND-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC3=C2C1=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
3-Nitroacenaphthene, Acenaphthene, 3-nitro-, 1,2-Dihydro-3-nitroacenaphthylene, Acenaphthylene, 1,2-dihydro-3-nitro-, 3-05-00-01783 (Beilstein Handbook Reference), Acenaphthylene, 1,2-dihydro-3-nitro-(9CI), 3-Nitro-1,2-dihydroacenaphthylene, 3-Nitro-acenaphthene; 1,2-Dihydro-3-nitroacenaphthylene; NSC 137392;, Oprea1_328327, WTRQPBAHQILXND-UHFFFAOYSA-N