CAS 3810-10-4 appears in our catalog under these names: (2–Aminopyridin–3–yl)(phenyl)methanone, (2-Aminopyridin-3-yl)(phenyl)methanone, 95%, 95%, (2-Aminopyridin-3-yl)(phenyl)methanone, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2-amino-3-pyridinyl)-phenylmethanone (CAS 3810-10-4) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: (2-amino-3-pyridinyl)-phenylmethanone. InChIKey: KROYVOKHXIFHMV-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (2-amino-3-pyridinyl)-phenylmethanone |
| InChIKey | KROYVOKHXIFHMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(N=CC=C2)N |
Computed by PubChem (NCBI)