CAS 381238-96-6 appears in our catalog under these names: 3,5-Dibromo-4-ethoxybenzaldehyde, 97%, 3,5-Dibromo-4-ethoxybenzaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
3,5-dibromo-4-ethoxybenzaldehyde (CAS 381238-96-6) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 3,5-dibromo-4-ethoxybenzaldehyde. InChIKey: XBXQIQJDJBMXJQ-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | 3,5-dibromo-4-ethoxybenzaldehyde |
| InChIKey | XBXQIQJDJBMXJQ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1Br)C=O)Br |
Computed by PubChem (NCBI)