Products 382596-25-0
CAS 382596-25-0 is the registry number for (Αr,βs)-β-(acetylamino)-α-hydroxy-4-(phenylmethoxy)-benzenepropanoic acid ethyl ester. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
Ethyl (2R,3S)-3-acetamido-2-hydroxy-3-(4-phenylmethoxyphenyl)propanoate (CAS 382596-25-0) is a chemical compound with the molecular formula C20H23NO5 and a molecular weight of 357.4 g/mol. IUPAC name: ethyl (2R,3S)-3-acetamido-2-hydroxy-3-(4-phenylmethoxyphenyl)propanoate. InChIKey: HRXCVPWHTCVYKB-RBUKOAKNSA-N.
| Molecular formula | C20H23NO5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | ethyl (2R,3S)-3-acetamido-2-hydroxy-3-(4-phenylmethoxyphenyl)propanoate |
| InChIKey | HRXCVPWHTCVYKB-RBUKOAKNSA-N |
| SMILES | CCOC(=O)[C@@H]([C@H](C1=CC=C(C=C1)OCC2=CC=CC=C2)NC(=O)C)O |
Computed by PubChem (NCBI)