CAS 38281-52-6 appears in our catalog under these names: 3-Bromobenzofuran-2-carbaldehyde, 3-Bromo-1-benzofuran-2-carbaldehyde. Offered by: TRC, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-bromo-1-benzofuran-2-carbaldehyde (CAS 38281-52-6) is a chemical compound with the molecular formula C9H5BrO2 and a molecular weight of 225.04 g/mol. IUPAC name: 3-bromo-1-benzofuran-2-carbaldehyde. InChIKey: XJHLNJBEPAUFOD-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2 |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 3-bromo-1-benzofuran-2-carbaldehyde |
| InChIKey | XJHLNJBEPAUFOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(O2)C=O)Br |
Computed by PubChem (NCBI)