CAS 383126-84-9 appears in our catalog under these names: 4-(3,4-Difluorophenoxy)aniline 95%, 4-(3,4-Difluorophenoxy)aniline, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
4-(3,4-difluorophenoxy)aniline (CAS 383126-84-9) is a chemical compound with the molecular formula C12H9F2NO and a molecular weight of 221.20 g/mol. IUPAC name: 4-(3,4-difluorophenoxy)aniline. InChIKey: IUXWEGLCUFEKGP-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO |
|---|---|
| Molecular weight | 221.20 g/mol |
| IUPAC name | 4-(3,4-difluorophenoxy)aniline |
| InChIKey | IUXWEGLCUFEKGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)