CAS 38313-16-5 is the registry number for 1,8-dibromo-9,10-Anthracenedione. Offered by: TRC. Available pack sizes: 2,5g.
1,8-dibromoanthracene-9,10-dione (CAS 38313-16-5) is a chemical compound with the molecular formula C14H6Br2O2 and a molecular weight of 366.00 g/mol. IUPAC name: 1,8-dibromoanthracene-9,10-dione. InChIKey: QIFCTRBXWWHIFG-UHFFFAOYSA-N.
| Molecular formula | C14H6Br2O2 |
|---|---|
| Molecular weight | 366.00 g/mol |
| IUPAC name | 1,8-dibromoanthracene-9,10-dione |
| InChIKey | QIFCTRBXWWHIFG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)C3=C(C2=O)C=CC=C3Br |
Computed by PubChem (NCBI)