CAS 53348-05-3 appears in our catalog under these names: 3,6–Dibromophenanthrene–9,10–dione, 3,6-Dibromophenanthrene-9,10-dione, >95.0%(HPLC), 3,6-Dibromophenanthrenequinone, 97%, 97%, 3,6-Dibromophenanthrene-9,10-dione, 95%, 3,6-Dibromophenanthrene-9,10-dione 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 10g, 25g, 1g, 50g, 250g, 500g, 1kg.
3,6-dibromophenanthrene-9,10-dione (CAS 53348-05-3) is a chemical compound with the molecular formula C14H6Br2O2 and a molecular weight of 366.00 g/mol. IUPAC name: 3,6-dibromophenanthrene-9,10-dione. InChIKey: WPEJBJRFPBMVGJ-UHFFFAOYSA-N.
| Molecular formula | C14H6Br2O2 |
|---|---|
| Molecular weight | 366.00 g/mol |
| IUPAC name | 3,6-dibromophenanthrene-9,10-dione |
| InChIKey | WPEJBJRFPBMVGJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C3=C(C=CC(=C3)Br)C(=O)C2=O |
Computed by PubChem (NCBI)