CAS 84405-44-7 appears in our catalog under these names: 2,7–Dibromophenanthrene–9,10–dione, 2,7-Dibromophenanthrene-9,10-dione, >95.0%(HPLC), 2,7-Dibromophenanthrene-9,10-dione 95%, 2,7-Dibromophenanthrene-9,10-dione, 95%+, 95%+, 2,7-Dibromophenanthrene-9,10-dione, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g, 1kg.
2,7-dibromophenanthrene-9,10-dione (CAS 84405-44-7) is a chemical compound with the molecular formula C14H6Br2O2 and a molecular weight of 366.00 g/mol. IUPAC name: 2,7-dibromophenanthrene-9,10-dione. InChIKey: LTZIIBSPYWTOQV-UHFFFAOYSA-N.
| Molecular formula | C14H6Br2O2 |
|---|---|
| Molecular weight | 366.00 g/mol |
| IUPAC name | 2,7-dibromophenanthrene-9,10-dione |
| InChIKey | LTZIIBSPYWTOQV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C(=O)C3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)