CAS 633-70-5 appears in our catalog under these names: 2,6–Dibromoanthracene–9,10–dione, 2,6-Dibromoanthraquinone, >95.0%(HPLC), 2,6-Dibromoanthraquinone, 2,6-Dibromoanthracene-9,10-dione, 93%+, 93%+, 2,6-Dibromoanthraquinone, 93%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 1g, 5g, 250mg, 50g, 1000g.
2,6-dibromoanthracene-9,10-dione (CAS 633-70-5) is a chemical compound with the molecular formula C14H6Br2O2 and a molecular weight of 366.00 g/mol. IUPAC name: 2,6-dibromoanthracene-9,10-dione. InChIKey: JUFYHUWBLXKCJM-UHFFFAOYSA-N.
| Molecular formula | C14H6Br2O2 |
|---|---|
| Molecular weight | 366.00 g/mol |
| IUPAC name | 2,6-dibromoanthracene-9,10-dione |
| InChIKey | JUFYHUWBLXKCJM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)C3=C(C2=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)