CAS 633-68-1 appears in our catalog under these names: 2,3-Dibromoanthracene-9,10-Dione, 97%, 97%, 2,3-Dibromoanthracene-9,10-dione, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,3-dibromoanthracene-9,10-dione (CAS 633-68-1) is a chemical compound with the molecular formula C14H6Br2O2 and a molecular weight of 366.00 g/mol. IUPAC name: 2,3-dibromoanthracene-9,10-dione. InChIKey: RECQBTCMRZKCQX-UHFFFAOYSA-N.
| Molecular formula | C14H6Br2O2 |
|---|---|
| Molecular weight | 366.00 g/mol |
| IUPAC name | 2,3-dibromoanthracene-9,10-dione |
| InChIKey | RECQBTCMRZKCQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C=C3C2=O)Br)Br |
Computed by PubChem (NCBI)