CAS 38380-01-7 appears in our catalog under these names: 2,2',4,4',5-Pentachlorobiphenyl, PCB No. 99, PCB No. 99 10 µg/mL in Isooctane, 2,2',4,4',5–Pentachlorobiphenyl, PCB 99, ROTI®Star, 5 mg, glass. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Roth, HPC Standards. Available pack sizes: 25mg, 5mg, 10ml, 1ml, 1x10ml.
1,2,4-trichloro-5-(2,4-dichlorophenyl)benzene (CAS 38380-01-7) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,4-trichloro-5-(2,4-dichlorophenyl)benzene. InChIKey: LMQJBFRGXHMNOX-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,4-trichloro-5-(2,4-dichlorophenyl)benzene |
| InChIKey | LMQJBFRGXHMNOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CC(=C(C=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)