Products 383892-69-1
CAS 383892-69-1 is the registry number for J1075. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-chloro-N-hydroxy-1-benzothiophene-2-carboxamide (CAS 383892-69-1) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: 3-chloro-N-hydroxy-1-benzothiophene-2-carboxamide. InChIKey: HRXULFWGEYSULN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | 3-chloro-N-hydroxy-1-benzothiophene-2-carboxamide |
| InChIKey | HRXULFWGEYSULN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)C(=O)NO)Cl |
Computed by PubChem (NCBI)