CAS 38397-07-8 appears in our catalog under these names: 2-Hydroxy-6-nitronaphthalene, 95%, 2-Hydroxy-6-nitronaphthalene. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 5g, 100mg.
6-nitronaphthalen-2-ol (CAS 38397-07-8) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 6-nitronaphthalen-2-ol. InChIKey: QDQYVGHTDXWLCN-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 6-nitronaphthalen-2-ol |
| InChIKey | QDQYVGHTDXWLCN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)