Products 38430-55-6
CAS 38430-55-6 appears in our catalog under these names: Ethyl 4-Acetylbenzoate, Ethyl 4–acetylbenzoate, 4-Acetylbenzoic acid ethyl ester, Ethyl 4-Acetylbenzoate, >97.0%(GC), Ethyl 4-acetylbenzoate 95%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 2,5g, 25g, 5g, 1g, 100g, 250g, 500g, 1000g.
Ethyl 4-acetylbenzoate (CAS 38430-55-6) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: ethyl 4-acetylbenzoate. InChIKey: GLOAPLPTWAXAIG-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | ethyl 4-acetylbenzoate |
| InChIKey | GLOAPLPTWAXAIG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 4-acetylbenzoate, GLOAPLPTWAXAIG-UHFFFAOYSA-N, 4-Acetylbenzoic acid ethyl ester, Benzoic acid, 4-acetyl-, ethyl ester, 4-Acetyl-benzoic acid ethyl ester, p-Acetylbenzoic acid ethyl ester, Ethyl 4-acetylbenzate, ethyl 4-acetyl benzoate, ethyl 4-acetyl-benzoate, Ethyl 4-acetylbenzoate, 99%