Products 38499-45-5

CAS 38499-45-5 is the registry number for 3-Amino-3-(4-methoxyphenyl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride (CAS 38499-45-5) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: 3-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride. InChIKey: LKZFSIJHSJAFJK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO3
Molecular weight231.67 g/mol
IUPAC name3-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride
InChIKeyLKZFSIJHSJAFJK-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C(CC(=O)O)N.Cl

Computed by PubChem (NCBI)