Products 38559-90-9
CAS 38559-90-9 appears in our catalog under these names: (4-Phenoxyphenoxy)acetic acid, 95%, 2-(4-Phenoxyphenoxy)acetic acid, 2-(4-Phenoxyphenoxy)acetic acid 97%, 2-(4-Phenoxyphenoxy)acetic acid, 97%, 97%, (4-Phenoxyphenoxy)acetic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 100mg.
2-(4-phenoxyphenoxy)acetic acid (CAS 38559-90-9) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 2-(4-phenoxyphenoxy)acetic acid. InChIKey: NUTWPVOGVQFHTI-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 2-(4-phenoxyphenoxy)acetic acid |
| InChIKey | NUTWPVOGVQFHTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)