CAS 387350-92-7 appears in our catalog under these names: 5-(Methylsulfonyl)indoline 95%, 5-(Methylsulfonyl)-indoline, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
5-methylsulfonyl-2,3-dihydro-1H-indole (CAS 387350-92-7) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 5-methylsulfonyl-2,3-dihydro-1H-indole. InChIKey: OFYOHQMIBTVTKY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 5-methylsulfonyl-2,3-dihydro-1H-indole |
| InChIKey | OFYOHQMIBTVTKY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)NCC2 |
Computed by PubChem (NCBI)