Products 38953-49-0
CAS 38953-49-0 is the registry number for 2-amino-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-amino-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one (CAS 38953-49-0) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 180.16 g/mol. IUPAC name: 2-amino-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one. InChIKey: KIUPQNQTVSNLOI-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-amino-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one |
| InChIKey | KIUPQNQTVSNLOI-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC(=N1)N)NC(=O)CO2 |
Computed by PubChem (NCBI)