Products 389614-94-2
CAS 389614-94-2 appears in our catalog under these names: EA4, EA4, 98.75%, EA4, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 100mg, 5mg, 50mg, 10 mg, 100 mg, 25 mg, 50 mg.
7-chloro-6-[4-(diethylamino)phenyl]quinoline-5,8-dione (CAS 389614-94-2) is a chemical compound with the molecular formula C19H17ClN2O2 and a molecular weight of 340.8 g/mol. IUPAC name: 7-chloro-6-[4-(diethylamino)phenyl]quinoline-5,8-dione. InChIKey: XAZVKSMDPVMMPP-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O2 |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 7-chloro-6-[4-(diethylamino)phenyl]quinoline-5,8-dione |
| InChIKey | XAZVKSMDPVMMPP-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)C2=C(C(=O)C3=C(C2=O)C=CC=N3)Cl |
Computed by PubChem (NCBI)