Products 618070-53-4

CAS 618070-53-4 is the registry number for Ethyl 1-(4-chlorobenzyl)-3-phenyl-1H-pyrazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

Ethyl 1-[(4-chlorophenyl)methyl]-3-phenylpyrazole-5-carboxylate (CAS 618070-53-4) is a chemical compound with the molecular formula C19H17ClN2O2 and a molecular weight of 340.8 g/mol. IUPAC name: ethyl 1-[(4-chlorophenyl)methyl]-3-phenylpyrazole-5-carboxylate. InChIKey: MBUXRFNLZCQKJX-UHFFFAOYSA-N.

Identity
Molecular formulaC19H17ClN2O2
Molecular weight340.8 g/mol
IUPAC nameethyl 1-[(4-chlorophenyl)methyl]-3-phenylpyrazole-5-carboxylate
InChIKeyMBUXRFNLZCQKJX-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=NN1CC2=CC=C(C=C2)Cl)C3=CC=CC=C3

Computed by PubChem (NCBI)