Products 391649-92-6
CAS 391649-92-6 is the registry number for 2-(2,2-dimethylpropanoyl)-3-(3-phenoxyphenyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg.
(2E)-4,4-dimethyl-3-oxo-2-[(3-phenoxyphenyl)methylidene]pentanenitrile (CAS 391649-92-6) is a chemical compound with the molecular formula C20H19NO2 and a molecular weight of 305.4 g/mol. IUPAC name: (2E)-4,4-dimethyl-3-oxo-2-[(3-phenoxyphenyl)methylidene]pentanenitrile. InChIKey: HAOFJCURRTWVBW-FOWTUZBSSA-N.
| Molecular formula | C20H19NO2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | (2E)-4,4-dimethyl-3-oxo-2-[(3-phenoxyphenyl)methylidene]pentanenitrile |
| InChIKey | HAOFJCURRTWVBW-FOWTUZBSSA-N |
| SMILES | CC(C)(C)C(=O)/C(=C/C1=CC(=CC=C1)OC2=CC=CC=C2)/C#N |
Computed by PubChem (NCBI)