CAS 39180-36-4 is the registry number for Methyl 2-nitro-(1,1'-biphenyl)-4-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
Methyl 3-nitro-4-phenylbenzoate (CAS 39180-36-4) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: methyl 3-nitro-4-phenylbenzoate. InChIKey: QLBQDTHLYXLDOV-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | methyl 3-nitro-4-phenylbenzoate |
| InChIKey | QLBQDTHLYXLDOV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)