CAS 39181-49-2 is the registry number for 5-((3-Chlorophenyl)methyl)-1,3,4-thiadiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-amine (CAS 39181-49-2) is a chemical compound with the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. IUPAC name: 5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-amine. InChIKey: JYCFJJIHQAFOMS-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3S |
|---|---|
| Molecular weight | 225.70 g/mol |
| IUPAC name | 5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | JYCFJJIHQAFOMS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC2=NN=C(S2)N |
Computed by PubChem (NCBI)