Products 3920-41-0

CAS 3920-41-0 is the registry number for 1,5-dimethyl-4-nitro-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

1,5-dimethyl-4-nitropyrazole-3-carboxylic acid (CAS 3920-41-0) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: 1,5-dimethyl-4-nitropyrazole-3-carboxylic acid. InChIKey: MPGVPPJLEAXGNP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7N3O4
Molecular weight185.14 g/mol
IUPAC name1,5-dimethyl-4-nitropyrazole-3-carboxylic acid
InChIKeyMPGVPPJLEAXGNP-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)