CAS 3920-41-0 is the registry number for 1,5-dimethyl-4-nitro-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1,5-dimethyl-4-nitropyrazole-3-carboxylic acid (CAS 3920-41-0) is a chemical compound with the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. IUPAC name: 1,5-dimethyl-4-nitropyrazole-3-carboxylic acid. InChIKey: MPGVPPJLEAXGNP-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O4 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | 1,5-dimethyl-4-nitropyrazole-3-carboxylic acid |
| InChIKey | MPGVPPJLEAXGNP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)