CAS 39205-68-0 appears in our catalog under these names: 1-Methyl-3-nitro-1H-pyrazole-4-carboxylic acid, 98%, 1-Methyl-3-nitro-1H-pyrazole-4-carboxylic acid, 1-Methyl-3-nitro-1H-pyrazole-4-carboxylic acid, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg.
1-methyl-3-nitropyrazole-4-carboxylic acid (CAS 39205-68-0) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: 1-methyl-3-nitropyrazole-4-carboxylic acid. InChIKey: SMXDRRLYXOTORT-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 1-methyl-3-nitropyrazole-4-carboxylic acid |
| InChIKey | SMXDRRLYXOTORT-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)