CAS 393085-45-5 appears in our catalog under these names: 2-Amino-4-(methylsulfonyl)benzoic acid, 95%, 2-Amino-4-(methylsulfonyl)benzoic Acid, >95% (HPLC), 2-Amino-4-(methylsulfonyl)benzoic acid, 2–Amino–4–(methylsulfonyl)benzoic acid, Mesotrion Metabolite AMBA. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 500mg, 25mg, 5g, 2,5g, 10MG.
2-amino-4-methylsulfonylbenzoic acid (CAS 393085-45-5) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 2-amino-4-methylsulfonylbenzoic acid. InChIKey: KFOGGDGNOLZBNY-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 2-amino-4-methylsulfonylbenzoic acid |
| InChIKey | KFOGGDGNOLZBNY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)C(=O)O)N |
Computed by PubChem (NCBI)