CAS 394-29-6 is the registry number for 5-Chloro-2-fluorobenzoyl chloride, 95%. Offered by: Fluorochem. Available pack sizes: 25g.
5-chloro-2-fluorobenzoyl chloride (CAS 394-29-6) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 5-chloro-2-fluorobenzoyl chloride. InChIKey: VWGAATKTEAKOCO-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 5-chloro-2-fluorobenzoyl chloride |
| InChIKey | VWGAATKTEAKOCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)Cl)F |
Computed by PubChem (NCBI)