CAS 39593-12-9 is the registry number for 4-Chloro-3,8-dimethylquinoline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-3,8-dimethylquinoline (CAS 39593-12-9) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 4-chloro-3,8-dimethylquinoline. InChIKey: VSAKKYYHSVQMEN-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 4-chloro-3,8-dimethylquinoline |
| InChIKey | VSAKKYYHSVQMEN-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=C(C=N2)C)Cl |
Computed by PubChem (NCBI)