CAS 39635-33-1 appears in our catalog under these names: 3,3',4,5,5'–Pentachlorobiphenyl, 3,3',4,5,5'-Pentachlorobiphenyl, PCB 127, ROTI®Star, 5 mg, glass, PCB 127, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: GLPBio, Biosynth, Roth, HPC Standards. Available pack sizes: 1ml, 10ml, 5ml, 25ml, 50ml, 5mg, 1x5ml.
1,2,3-trichloro-5-(3,5-dichlorophenyl)benzene (CAS 39635-33-1) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,3-trichloro-5-(3,5-dichlorophenyl)benzene. InChIKey: MXVAYAXIPRGORY-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,3-trichloro-5-(3,5-dichlorophenyl)benzene |
| InChIKey | MXVAYAXIPRGORY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=CC(=C(C(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)