CAS 3972-36-9 appears in our catalog under these names: (S)–Benzylsuccinic Acid, (S)-Benzylsuccinic Acid, >98.0%(HPLC)(T), (S)-2-Benzylsuccinic acid 97%, (S)-2-Benzylsuccinic acid, 97%, 97%, (S)-2-Benzylsuccinic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 500g, 1g, 10g.
(2S)-2-benzylbutanedioic acid (CAS 3972-36-9) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (2S)-2-benzylbutanedioic acid. InChIKey: GTOFKXZQQDSVFH-VIFPVBQESA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (2S)-2-benzylbutanedioic acid |
| InChIKey | GTOFKXZQQDSVFH-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)