CAS 3977-48-8 appears in our catalog under these names: 4,6–Diphenylpyrimidine, 4,6-Diphenylpyrimidine 97%, 4,6-Diphenylpyrimidine, 97%, 97%, 4,6-Diphenylpyrimidine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,6-diphenylpyrimidine (CAS 3977-48-8) is a chemical compound with the molecular formula C16H12N2 and a molecular weight of 232.28 g/mol. IUPAC name: 4,6-diphenylpyrimidine. InChIKey: BWRMZQGIDWILAU-UHFFFAOYSA-N.
| Molecular formula | C16H12N2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 4,6-diphenylpyrimidine |
| InChIKey | BWRMZQGIDWILAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)