CAS 39774-28-2 appears in our catalog under these names: 6-Phenylpyridine-2-carboxylic acid, 98%, 6-Phenylpyridine-2-carboxylic Acid, >95% (HPLC), 6-Phenylpyridine-2-carboxylic Acid, >98.0%(GC)(T), 6-Phenylpicolinic acid 95%, 6-Phenylpicolinic Acid, 95%, 95%. Offered by: Fluorochem, TRC, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
6-phenylpyridine-2-carboxylic acid (CAS 39774-28-2) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 6-phenylpyridine-2-carboxylic acid. InChIKey: CXOPUGLYEYDAMC-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 6-phenylpyridine-2-carboxylic acid |
| InChIKey | CXOPUGLYEYDAMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)