CAS 39784-11-7 is the registry number for (4-Chloro-3-methylphenoxy)acetyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(4-chloro-3-methylphenoxy)acetyl chloride (CAS 39784-11-7) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 2-(4-chloro-3-methylphenoxy)acetyl chloride. InChIKey: AWRKVXYENKPUPW-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2-(4-chloro-3-methylphenoxy)acetyl chloride |
| InChIKey | AWRKVXYENKPUPW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC(=O)Cl)Cl |
Computed by PubChem (NCBI)