Products 397868-44-9

CAS 397868-44-9 is the registry number for 2-(Fmoc-amino)-6-heptenoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)hept-6-enoic acid (CAS 397868-44-9) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)hept-6-enoic acid. InChIKey: LRSIYGFZZWFAAI-UHFFFAOYSA-N.

Identity
Molecular formulaC22H23NO4
Molecular weight365.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)hept-6-enoic acid
InChIKeyLRSIYGFZZWFAAI-UHFFFAOYSA-N
SMILESC=CCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)