Products 39891-71-9

CAS 39891-71-9 appears in our catalog under these names: 2,3-Dihydro-1H-indole-3-carboxylic acid methyl ester, 95%, Methyl indoline-3-carboxylate 95%, Methyl indoline-3-carboxylate, 95%, 95%, Methyl indoline-3-carboxylate, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 500mg, 25g.

Structural formula: {0} (CAS {1})

Methyl 2,3-dihydro-1H-indole-3-carboxylate (CAS 39891-71-9) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: methyl 2,3-dihydro-1H-indole-3-carboxylate. InChIKey: QLMBVRCJGIGWBV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO2
Molecular weight177.20 g/mol
IUPAC namemethyl 2,3-dihydro-1H-indole-3-carboxylate
InChIKeyQLMBVRCJGIGWBV-UHFFFAOYSA-N
SMILESCOC(=O)C1CNC2=CC=CC=C12

Computed by PubChem (NCBI)