Products 39911-72-3
CAS 39911-72-3 appears in our catalog under these names: 3，5–Dicarboxypyridine 1–oxide, 3,5-Dicarboxypyridine 1-oxide 98%, 3,5-Dicarboxypyridine 1-oxide, 98%, 98%, 3,5-Dicarboxypyridine 1-oxide, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
1-oxidopyridin-1-ium-3,5-dicarboxylic acid (CAS 39911-72-3) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 1-oxidopyridin-1-ium-3,5-dicarboxylic acid. InChIKey: WDSXNMIWCDXWJS-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 1-oxidopyridin-1-ium-3,5-dicarboxylic acid |
| InChIKey | WDSXNMIWCDXWJS-UHFFFAOYSA-N |
| SMILES | C1=C(C=[N+](C=C1C(=O)O)[O-])C(=O)O |
Computed by PubChem (NCBI)