CAS 6624-53-9 appears in our catalog under these names: Cis-4-nitrostilbene, 95%, (Z)-1-Nitro-4-styrylbenzene, 97%, cis–4–Nitrostilbene, cis-4-Nitrostilbene, >97.0%(GC), cis-4-Nitrostilbene. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Biosynth. Available pack sizes: 1g, 200mg, 250mg.
1-nitro-4-[(Z)-2-phenylethenyl]benzene (CAS 6624-53-9) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 1-nitro-4-[(Z)-2-phenylethenyl]benzene. InChIKey: ZISCOWXWCHUSMH-SREVYHEPSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 1-nitro-4-[(Z)-2-phenylethenyl]benzene |
| InChIKey | ZISCOWXWCHUSMH-SREVYHEPSA-N |
| SMILES | C1=CC=C(C=C1)/C=C\C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)