CAS 4004-95-9 appears in our catalog under these names: 1-Phenylpiperazine Dihydrochloride, >95% (HPLC), Phenylpiperazine (hydrochloride), 1-Phenylpiperazine Dihydrochloride, Phenylpiperazine (hydrochloride). Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 10mg, 100mg, 50mg, 500mg, 250mg, 50 mg, 25 mg.
1-phenylpiperazine;dihydrochloride (CAS 4004-95-9) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 1-phenylpiperazine;dihydrochloride. InChIKey: CUTPTQNQXVVRDB-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 1-phenylpiperazine;dihydrochloride |
| InChIKey | CUTPTQNQXVVRDB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)