CAS 400750-09-6 appears in our catalog under these names: 3'-Fluoro-(1,1'-biphenyl)-3-carbaldehyde, 98%, 3-(3-Fluorophenyl)benzaldehyde, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 100mg, 500mg.
3-(3-fluorophenyl)benzaldehyde (CAS 400750-09-6) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: 3-(3-fluorophenyl)benzaldehyde. InChIKey: JKHXPCVGTFXSES-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 3-(3-fluorophenyl)benzaldehyde |
| InChIKey | JKHXPCVGTFXSES-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)F)C=O |
Computed by PubChem (NCBI)