CAS 7326-79-6 appears in our catalog under these names: 3-(Pyrrolidine-1-sulfonyl)-benzoic acid, 98%, 3-(Pyrrolidine-1-sulfonyl)-benzoic acid, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 50mg.
3-pyrrolidin-1-ylsulfonylbenzoic acid (CAS 7326-79-6) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 3-pyrrolidin-1-ylsulfonylbenzoic acid. InChIKey: UZMCSTKSVWZMJA-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 3-pyrrolidin-1-ylsulfonylbenzoic acid |
| InChIKey | UZMCSTKSVWZMJA-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)