CAS 401577-80-8 is the registry number for methyl 3-(methoxycarbonyl)-5-((phenylamino)carbonylamino)benzoate. Offered by: Biosynth. Available pack sizes: 250mg.
Dimethyl 5-(phenylcarbamoylamino)benzene-1,3-dicarboxylate (CAS 401577-80-8) is a chemical compound with the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. IUPAC name: dimethyl 5-(phenylcarbamoylamino)benzene-1,3-dicarboxylate. InChIKey: WQFBGPQIFHDFRJ-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O5 |
|---|---|
| Molecular weight | 328.32 g/mol |
| IUPAC name | dimethyl 5-(phenylcarbamoylamino)benzene-1,3-dicarboxylate |
| InChIKey | WQFBGPQIFHDFRJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)NC(=O)NC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)