Products 40195-49-1

CAS 40195-49-1 is the registry number for methyl 3-oxo-2,4-diphenylbutanoate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-oxo-2,4-diphenylbutanoate (CAS 40195-49-1) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: methyl 3-oxo-2,4-diphenylbutanoate. InChIKey: LSMCJQFYFLVEFW-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16O3
Molecular weight268.31 g/mol
IUPAC namemethyl 3-oxo-2,4-diphenylbutanoate
InChIKeyLSMCJQFYFLVEFW-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=CC=CC=C1)C(=O)CC2=CC=CC=C2

Computed by PubChem (NCBI)