Products 4023-80-7
CAS 4023-80-7 appears in our catalog under these names: 1-(4-Methoxyphenyl)butane-1,3-dione, 95%, 1-(4-Methoxyphenyl)butane-1,3-dione 98%, 1-(4-Methoxyphenyl)butane-1,3-dione, 98%, 98%, 1-(4-methoxyphenyl)butane-1,3-dione, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 100mg.
1-(4-methoxyphenyl)butane-1,3-dione (CAS 4023-80-7) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 1-(4-methoxyphenyl)butane-1,3-dione. InChIKey: PVCFQGTUBKQIMH-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)butane-1,3-dione |
| InChIKey | PVCFQGTUBKQIMH-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)
Synonyms:
1-(4-Methoxyphenyl)butane-1,3-dione, 1-(4-Methoxyphenyl)-1,3-butanedione, 1,3-Butanedione, 1-(4-methoxyphenyl)-, 4-Methoxybenzoylacetone, 4-Methoxybenzoyl acetone, 1-(4-methoxy-phenyl)-butane-1,3-dione, Trifluralin Impurity 5 (Profluralin), 1-(4-methoxyphenyl)-butane-1,3-dione, 1- (p-methoxyphenyl) -1,3-butanedione, 1-(4-Methoxyphenyl)-1,3-butanedione #