CAS 40361-70-4 is the registry number for 2–(2–(4–chlorophenyl)thiazol–4–yl)ethanaMine. Offered by: GLPBio. Available pack sizes: 25mg.
N-[2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]ethyl]acetamide (CAS 40361-70-4) is a chemical compound with the molecular formula C13H13ClN2OS and a molecular weight of 280.77 g/mol. IUPAC name: N-[2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]ethyl]acetamide. InChIKey: BQDMNNRQRSNJFF-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2OS |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | N-[2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]ethyl]acetamide |
| InChIKey | BQDMNNRQRSNJFF-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCC1=CSC(=N1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)