CAS 756859-01-5 appears in our catalog under these names: N-(4-(Chloromethyl)-1,3-thiazol-2-yl)-N-(3-methylphenyl)acetamide, 95%, N-(4-(Chloromethyl)-1,3-thiazol-2-yl)-N-(3-methylphenyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3-methylphenyl)acetamide (CAS 756859-01-5) is a chemical compound with the molecular formula C13H13ClN2OS and a molecular weight of 280.77 g/mol. IUPAC name: N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3-methylphenyl)acetamide. InChIKey: ROENKKPAMXVNKV-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2OS |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(3-methylphenyl)acetamide |
| InChIKey | ROENKKPAMXVNKV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=NC(=CS2)CCl)C(=O)C |
Computed by PubChem (NCBI)