CAS 545437-12-5 is the registry number for 2-Chloro-N-(4-(4-ethylphenyl)-1,3-thiazol-2-yl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide (CAS 545437-12-5) is a chemical compound with the molecular formula C13H13ClN2OS and a molecular weight of 280.77 g/mol. IUPAC name: 2-chloro-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide. InChIKey: ZRXDNVDKGJONNC-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2OS |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | 2-chloro-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide |
| InChIKey | ZRXDNVDKGJONNC-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CSC(=N2)NC(=O)CCl |
Computed by PubChem (NCBI)